(S)-9,10-Difluro-3-methyl-7-oxo-2,3-dihydro-7H-pyrido[1,2,3-de][1,4]benzoxazine-6-carboxylic acid
Product Description
| Product | (S)-9,10-Difluro-3-methyl-7-oxo-2,3-dihydro-7H-pyrido[1,2,3-de][1,4]benzoxazine-6-carboxylic acid |
| CAS | 100986-89-8 |
| Formula | C13H9F2NO4 |
| Synonym | (-)-9,10-DIFLUORO-3(S)-METHYL-7-OXO-2,3-DIHYDRO-7H-PYRIDO (1,2,3-DE)-1,4-BENZOXAZINE-6-CARBOXYLIC ACID, S-(-)-9,10-DIFLUORO-2,3-DIHYDRO-3-METHYL-7-OXO-7H-PYRIDO-[1,2,3-DE] [1,4]-BENZOXAZINE-6-CARBOXYLIC ACID, 8,9-difluoro-3-methyl-6-oxo-2,3-dihydro-6H-1-oxa-3a-aza-phenalene-5-carboxylic acid, LEVOFLUOROCARBOXYLIC ACID, S(-)-9,10-DIFL-2,3-DIHYDRO-3-ME-7H-PYRI&, (-)-9,10-DIFLUORO-3(S)-METHYL-7-OXO-2,3-DIHYDRO-7H- PYRIDO (1,2,3-DE)-1,4-BENZOXAZINE-6-CARBOXYLIC ACID, S-(-)-9,10-DIFLUORO-2,3-DIHYDRO-3-METHYL-7-OXO-7H-PYRIDO-[1,2,3-DE][1,4]-BENZOXAZINE-6-CARBOXYLIC ACID, 9,10-Difluoro-3(S)-methyl-7-oxo-2,3-dihyd, Levofloxacin carboxylic acid, (S)-(-)-9,10-Difluoro-2,3-dihydro-3-methyl-7-oxo-7H-pyrido(1,2,3-de)(1,4)benzoxazine-6-carboxylic acid, 7H-Pyrido(1,2,3-de)-1,4-benzoxazine-6-carboxylic acid, 9,10-difluoro-2,3-dihydro-3-methyl-7-oxo-, (3S)-, Levofloxacin q-acid, Levofloxacin q-acid, (-)-, Levofloxacin related compound B, Levofloxacin related compound B RS [USP], Levofloxacin related compound B [USP], UNII-08GT8FY84E |
Typical Product Specifications
| InChI | 1S/C15H10N2O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19/h1-8H,9H2 |
| Flash Point | 196 °C |
| Boiling Point | 392 °C |
| Density | 1.19 |
| Melting Point | 38-44 °C |
| BRN Number | 797662 |
| Molecular weight | 281.21 |
| SMILES | C[C@H]1COc2c3n1cc(c(=O)c3cc(c2F)F)C(=O)O |
| Melting Point | >300 °C |
| Storage Temperature | Refrigerator |
| Water solubility | decomposes |
| Molecular weight | 250.25 |
| SMILES | c1cc(ccc1Cc2ccc(cc2)N=C=O)N=C=O |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. Reacts violently with alcohols. |
| Sensitive | Moisture Sensitive/Lachrymatory |
| Freezing Point | 37? |
| Storage Temperature | Refrigerator |
| Freezing Point | 37? |
| Vapor Pressure | 5.00E-06 mm Hg |
| Henry's Law Constant | 8.95E-07 atm-m3/mole |
| Melting Point | 38 ° C |
| log P (octanol-water) | 5.220 |
| Water solubility | 0.829 mg/L |
| Atmospheric OH Rate Constant | 1.20E-11 cm3/molecule-sec |
| Freezing Point | 37? |
| EINECS | 202-966-0 |
| Class | Specialty Chemicals |
| Industry | Adhesives, Rubber |

Find another Material
Enter a chemical name, synonym or CAS# below





