| Molecular weight | 127.10 |
| SMILES | c1([N+]([O-])=O)nn(C)cc1 |
| InChI | 1S/C4H5N3O2/c1-6-3-2-4(5-6)7(8)9/h2-3H,1H3 |
| Molecular weight | 147.09 |
| EINECS | 200-730-1 |
| SMILES | C(N(N=O)C)(N[N+](=O)[O-])=N |
| InChI | 1S/C2H5N5O3/c1-6(5-8)2(3)4-7(9)10/h1H3,(H2,3,4) |
| Atmospheric OH Rate Constant | 1.26E-12 cm3/molecule-sec |
| Melting Point | 118 (dec) ° C |
| Water solubility | 2.67E+05 mg/L |
| log P (octanol-water) | -0.920 |
| Henry's Law Constant | 1.22E-12 atm-m3/mole |
| Vapor Pressure | 1.20E-04 mm Hg |
| Water solubility | Reacts violently |
| Melting Point | 118°C (dec.) |
| Storage Temperature | 0-6°C |
| Stability | Unstable. Reacts violently with water. May detonate under impact. Heat, light and moisture sensitive. May explode if stored in sealed ampules. Highly flammable. Incompatible with aqueous solutions, acids, bases, oxidizing agents, reducing agents |
| Merck | 6103 |
| Class | Specialty Chemicals |
