4-Methoxymethylphenylboronic acid
Product Description
| Product | 4-Methoxymethylphenylboronic acid |
| CAS | 279262-11-2 |
| Formula | C8 H11 B O3 |
| Synonym | 4-(Methoxymethyl)phenylboronic Acid (contains varying amounts of Anhydride), 4-METHOXYMETHYLBENZENEBORONIC ACID |
Typical Product Specifications
| Molecular weight | 165.98 |
| SMILES | COCc1ccc(cc1)B(O)O |
| Molecular weight | 250.25 |
| EINECS | 202-966-0 |
| SMILES | O=C=Nc1ccc(Cc2ccc(cc2)N=C=O)cc1 |
| Flash Point | 196 °C |
| Boiling Point | 392 °C |
| Density | 1.19 |
| BRN Number | 797662 |
| Water solubility | decomposes |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. Reacts violently with alcohols. |
| Sensitive | Moisture Sensitive/Lachrymatory |
| Freezing Point | 37? |
| Storage Temperature | Refrigerator |
| Molecular weight | 250.25 |
| EINECS | 202-966-0 |
| SMILES | O=C=Nc1ccc(Cc2ccc(cc2)N=C=O)cc1 |
| Flash Point | 196 °C |
| Boiling Point | 392 °C |
| Density | 1.19 |
| Melting Point | 38-44 °C |
| BRN Number | 797662 |
| Water solubility | decomposes |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. Reacts violently with alcohols. |
| Sensitive | Moisture Sensitive/Lachrymatory |
| Freezing Point | 37? |
| Storage Temperature | Refrigerator |
| Melting Point | 38-44 °C |
| Class | Specialty Chemicals |
| Function | Acid |
| Industry | Adhesives, Rubber |
Find another Material
Enter a chemical name, synonym or CAS# below
