| Molecular weight | 380.44 |
| EINECS | 201-635-8 |
| SMILES | c12c(\N=N\c3c(cc(\N=N\c4c(cccc4)C)cc3)C)c(ccc1cccc2)O |
| InChI | 1S/C24H20N4O/c1-16-7-3-6-10-21(16)26-25-19-12-13-22(17(2)15-19)27-28-24-20-9-5-4-8-18(20)11-14-23(24)29/h3-15,29H,1-2H3 |
| log P (octanol-water) | 8.720 |
| Melting Point | 186 dec ° C |
| Atmospheric OH Rate Constant | 2.01E-11 cm3/molecule-sec |
| Molecular weight | 303.83 |
| EINECS | 219-567-2 |
| Molecular weight | 120.38 |
| InChI | 1S/CHCl3/c2-1(3)4/h1H/i1D |
| Molecular weight | 340.41 |
| InChI | 1S/C21H24O4/c1-21(2,15-3-7-17(8-4-15)22-11-19-13-24-19)16-5-9-18(10-6-16)23-12-20-14-25-20/h3-10,19-20H,11-14H2,1-2H3 |
| Storage Temperature | 2-8°C |
| Water solubility | Soluble in 100% ethanol, dimethyl sulfoxide (100 mM), dimethyl formamide, chloroform, methanol, and ethanol (50 mM). Insoluble in water. |
| Melting Point | 40-44 °C |
| Refractive Index | 1.5735 |
| BRN Number | 299026 |
| Density | 1,17 g/cm3 |
| Boiling Point | 210 °C / 1mmHg |
| SMILES | C(c1ccc(N(C)C)cc1)(c1ccc(N(C)C)cc1)=N.Cl |
| InChI | 1S/C17H21N3.ClH/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4;/h5-12,18H,1-4H3;1H |
| Water solubility | Soluble in water or ethanol |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Colour Index | 41000 |
| Storage Temperature | Store at room temperature. |
| Melting Point | >250 °C (dec.) |
| Atmospheric OH Rate Constant | 2.05E-10 cm3/molecule-sec |
| log P (octanol-water) | 2.980 |
| Water solubility | 1.00E+04 mg/L |
| Henry's Law Constant | 3.64E-09 atm-m3/mole |
| Vapor Pressure | 1.29E-06 mm Hg |
| Molecular weight | 250.25 |
| SMILES | c1cc(ccc1Cc2ccc(cc2)N=C=O)N=C=O |
| InChI | 1S/C15H10N2O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19/h1-8H,9H2 |
| Flash Point | 196 °C |
| Boiling Point | 392 °C |
| Melting Point | 38-44 °C |
| BRN Number | 797662 |
| Water solubility | decomposes |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. Reacts violently with alcohols. |
| Sensitive | Moisture Sensitive/Lachrymatory |
| Freezing Point | 37? |
| Storage Temperature | Refrigerator |
| Freezing Point | 37? |
| Vapor Pressure | 5.00E-06 mm Hg |
| Henry's Law Constant | 8.95E-07 atm-m3/mole |
| Melting Point | 38 ° C |
| log P (octanol-water) | 5.220 |
| Water solubility | 0.829 mg/L |
| Atmospheric OH Rate Constant | 1.20E-11 cm3/molecule-sec |
| Freezing Point | 37? |
| Density | 1.19 |
| Class | Specialty Chemicals |
| Function | Acid, Stabilizer |
| Industry | Adhesives, Rubber, Organics |