| log P (octanol-water) | 7.600 |
| Molecular weight | 250.25 |
| SMILES | c1cc(ccc1Cc2ccc(cc2)N=C=O)N=C=O |
| InChI | 1S/C15H10N2O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19/h1-8H,9H2 |
| Flash Point | 196 °C |
| Boiling Point | 392 °C |
| Molecular weight | 210.40 |
| InChI | 1S/C15H30/c1-2-4-6-8-10-12-14-15-13-11-9-7-5-3-1/h1-15H2 |
| Melting Point | 61.3 ° C |
| Density | 1.19 |
| Atmospheric OH Rate Constant | 2.12E-11 cm3/molecule-sec |
| Melting Point | 38-44 °C |
| BRN Number | 797662 |
| Water solubility | decomposes |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. Reacts violently with alcohols. |
| Sensitive | Moisture Sensitive/Lachrymatory |
| Freezing Point | 37? |
| Storage Temperature | Refrigerator |
| Freezing Point | 37? |
| Vapor Pressure | 5.00E-06 mm Hg |
| Henry's Law Constant | 8.95E-07 atm-m3/mole |
| Melting Point | 38 ° C |
| log P (octanol-water) | 5.220 |
| Water solubility | 0.829 mg/L |
| Atmospheric OH Rate Constant | 1.20E-11 cm3/molecule-sec |
| Class | Specialty Chemicals, Specialty Materials |
| Industry | Adhesives, Rubber |
