3,3''-Diaminobenzidine
Product Description
| Product | 3,3''-Diaminobenzidine |
| CAS | 91-95-2 |
| Formula | C12H14N4 |
| Synonym | 3,3',4,4'-BIPHENYLTETRAMIN, 3,4,3',4'-TETRAAMINOBIPHENYL, TIMTEC-BB SBB008427, 3,3',4,4'-Tetraaminobiphenyl, biphenyl-3,3',4,4'-tetrayltetraamine, 3,3',4,4'-Tetraminobiphenyl, NSC 76152, DAB, 3,3',4,4'-BIPHENYLTETRAMINE, 3,3',4,4'-Diphenyltetramine, 3,3'-Diaminobenzidine, 3,3',4,4'-Tetraaminodiphenyl, [1,1'-Biphenyl]-3,3',4,4'-tetramine |
Typical Product Specifications
| Molecular weight | 214.27 |
| EINECS | 202-110-6 |
| SMILES | Nc1ccc(cc1N)c2ccc(N)c(N)c2 |
| InChI | 1S/C12H14N4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H,13-16H2 |
| Form | tablet |
| Water solubility | 0.55 g/L (20 ºC) |
| Stability | Stability Moisture and light sensitive. Incompatible with strong oxidizing agents. |
| Storage Temperature | 2-8°C |
| Flash Point | 12 °C |
| Melting Point | 175-177 °C |
| Class | Amines |
| Function | Substrate, Enzyme |
Find another Material
Enter a chemical name, synonym or CAS# below
