| Molecular weight | 378.90 |
| Melting Point | 285 °C (dec.) |
| Molecular weight | 268.35 |
| EINECS | 200-278-5 |
| SMILES | C(=C(\c1ccc(O)cc1)CC)(\c1ccc(O)cc1)CC |
| InChI | 1S/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3/b18-17+ |
| Melting Point | 170.5 ° C |
| Henry's Law Constant | 5.80E-12 atm-m3/mole |
| log P (octanol-water) | 5.07 |
| Atmospheric OH Rate Constant | 1.75E-10 cm3/molecule-sec |
| Vapor Pressure | 1.41E-08 mm Hg |
| Water solubility | 12 mg/L |
| Storage Temperature | 0-6°C |
| Merck | 13,3155 |
| Melting Point | 170-172 °C |
| Stability | Isomerizes rapidly in Benzene, Chloroform, and Ether. Keep Shielded from light. |
| Water solubility | PRACTICALLY INSOLUBLE |
| Solubility | methanol: 0.1 g/mL, clear, faintly yellow |
| Molecular weight | 268.35 |
| EINECS | 200-278-5 |
| InChI | 1S/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3/b18-17+ |
| Melting Point | 170.5 ° C |
| Henry's Law Constant | 5.80E-12 atm-m3/mole |
| log P (octanol-water) | 5.07 |
| Atmospheric OH Rate Constant | 1.75E-10 cm3/molecule-sec |
| Vapor Pressure | 1.41E-08 mm Hg |
| Water solubility | 12 mg/L |
| Storage Temperature | 0-6°C |
| Merck | 13,3155 |
| Melting Point | 170-172 °C |
| Stability | Isomerizes rapidly in Benzene, Chloroform, and Ether. Keep Shielded from light. |
| Water solubility | PRACTICALLY INSOLUBLE |
| Solubility | methanol: 0.1 g/mL, clear, faintly yellow |
| Class | Specialty Chemicals |
| Function | Intermediates |
| Industry | Pharmaceutical |