| Molecular weight | 413.00 |
| EINECS | 242-069-1 |
| SMILES | P(Oc1c(cc(I)c(c1)Cl)Cl)(OC)(OC)=S |
| InChI | 1S/C8H8Cl2IO3PS/c1-12-15(16,13-2)14-8-4-5(9)7(11)3-6(8)10/h3-4H,1-2H3 |
| Vapor Pressure | 8.25E-07 mm Hg |
| Atmospheric OH Rate Constant | 5.88E-11 cm3/molecule-sec |
| log P (octanol-water) | 5.51 |
| Melting Point | 72-73 ° C |
| Water solubility | 0.1 mg/L |
| Henry's Law Constant | 4.48E-06 atm-m3/mole |
| Notes | PVP/DMAPA acrylates copolymer is a Copolymer of vinylpyrrolidone and dimethylaminopropyl methacrylamide PVP/DMAPA acrylates copolymer uses and applications include: Film-former, conditioner, bodying agent for hair care |
| Class | Specialty Chemicals |
